C25H24N4O5 — CID 90298856
(2R)-2-[3-[4-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]phenyl]prop-2-ynoylamino]propanoic acid (PubChem CID 90298856) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is (2R)-2-[3-[4-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]phenyl]prop-2-ynoylamino]propanoic acid.
| Compound Name | (2R)-2-[3-[4-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]phenyl]prop-2-ynoylamino]propanoic acid |
|---|---|
| PubChem CID | 90298856 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (2R)-2-[3-[4-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]phenyl]prop-2-ynoylamino]propanoic acid |
| SMILES | C[C@@H](NC(=O)C#Cc1ccc(-c2cnn(C)c2NC(=O)O[C@H](C)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H24N4O5/c1-16(24(31)32)27-22(30)14-11-18-9-12-20(13-10-18)21-15-26-29(3)23(21)28-25(33)34-17(2)19-7-5-4-6-8-19/h4-10,12-13,15-17H,1-3H3,(H,27,30)(H,28,33)(H,31,32)/t16-,17-/m1/s1 |
| InChIKey | MFDIEDHAZJJRDQ-IAGOWNOFSA-N |
| XLogP | 3.34 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|