C32H33B2F4NO5S — CID 90299390
1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-[5-(trifluoromethyl)thiophen-2-yl]-6H-indolo[1,2-c][1,3]benzoxazine (PubChem CID 90299390) has the molecular formula C32H33B2F4NO5S and a molecular weight of 641.30 g/mol. Its IUPAC name is 1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-[5-(trifluoromethyl)thiophen-2-yl]-6H-indolo[1,2-c][1,3]benzoxazine.
| Compound Name | 1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-[5-(trifluoromethyl)thiophen-2-yl]-6H-indolo[1,2-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 90299390 |
| Molecular Formula | C32H33B2F4NO5S |
| Molecular Weight | 641.30 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-[5-(trifluoromethyl)thiophen-2-yl]-6H-indolo[1,2-c][1,3]benzoxazine |
| SMILES | CC1(C)OB(c2cc(F)c3c(c2)OC(c2ccc(C(F)(F)F)s2)n2c-3cc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)OC1(C)C |
| InChI | InChI=1S/C32H33B2F4NO5S/c1-28(2)29(3,4)42-33(41-28)18-9-10-21-17(13-18)14-22-26-20(35)15-19(34-43-30(5,6)31(7,8)44-34)16-23(26)40-27(39(21)22)24-11-12-25(45-24)32(36,37)38/h9-16,27H,1-8H3 |
| InChIKey | APIHFWGGECJYEF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.30 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|