C14H21N7O7P+ — CID 90300255
[(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-oxophosphanium (PubChem CID 90300255) has the molecular formula C14H21N7O7P+ and a molecular weight of 430.34 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-oxophosphanium.
| Compound Name | [(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-oxophosphanium |
|---|---|
| PubChem CID | 90300255 |
| Molecular Formula | C14H21N7O7P+ |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [(2R,3S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-oxophosphanium |
| SMILES | COC(=O)[C@H](C)N[P+](=O)OC[C@H]1OC(n2ccc(N)nc2=O)[C@](C)(N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C14H20N7O7P/c1-7(11(23)26-3)18-29(25)27-6-8-10(22)14(2,19-20-16)12(28-8)21-5-4-9(15)17-13(21)24/h4-5,7-8,10,12,22H,6H2,1-3H3,(H2-,15,17,18,24,25)/p+1/t7-,8+,10+,12?,14+/m0/s1 |
| InChIKey | ABZUOZIXWYUSFF-AECQIOICSA-O |
| XLogP | -0.02 |
| TPSA | 203.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|