C26H44N4O8 — CID 90303007
1,7,7-trimethyltricyclo[2.2.1.02,6]heptane;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 90303007) has the molecular formula C26H44N4O8 and a molecular weight of 540.66 g/mol. Its IUPAC name is 1,7,7-trimethyltricyclo[2.2.1.02,6]heptane;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 1,7,7-trimethyltricyclo[2.2.1.02,6]heptane;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 90303007 |
| Molecular Formula | C26H44N4O8 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 1,7,7-trimethyltricyclo[2.2.1.02,6]heptane;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC1(C)C2CC3C(C2)C31C.O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H28N4O8.C10H16/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;1-9(2)6-4-7-8(5-6)10(7,9)3/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);6-8H,4-5H2,1-3H3 |
| InChIKey | NWLFGEOSBKDIKU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |