C24H16BrN — CID 90306273
4-(10-bromo-15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaenyl)benzonitrile (PubChem CID 90306273) has the molecular formula C24H16BrN and a molecular weight of 398.30 g/mol. Its IUPAC name is 4-(10-bromo-15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaenyl)benzonitrile.
| Compound Name | 4-(10-bromo-15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaenyl)benzonitrile |
|---|---|
| PubChem CID | 90306273 |
| Molecular Formula | C24H16BrN |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 4-(10-bromo-15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaenyl)benzonitrile |
| SMILES | CC1(C)c2cc(Br)cc3ccc4cc(-c5ccc(C#N)cc5)cc1c4c23 |
| InChI | InChI=1S/C24H16BrN/c1-24(2)20-11-18(15-5-3-14(13-26)4-6-15)9-16-7-8-17-10-19(25)12-21(24)23(17)22(16)20/h3-12H,1-2H3 |
| InChIKey | DUBVMXIILVOSDW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|