C13H20O3S — CID 90306600
7-hexyl-5-methoxy-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 90306600) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 7-hexyl-5-methoxy-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 7-hexyl-5-methoxy-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 90306600 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 7-hexyl-5-methoxy-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCCCCCc1sc(OC)c2c1OCCO2 |
| InChI | InChI=1S/C13H20O3S/c1-3-4-5-6-7-10-11-12(13(14-2)17-10)16-9-8-15-11/h3-9H2,1-2H3 |
| InChIKey | SCMZRDKXHXSVAS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|