C28H28O6S4 — CID 101124360
5-[2,5-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-hexylthiophen-3-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 101124360) has the molecular formula C28H28O6S4 and a molecular weight of 588.79 g/mol. Its IUPAC name is 5-[2,5-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-hexylthiophen-3-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[2,5-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-hexylthiophen-3-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 101124360 |
| Molecular Formula | C28H28O6S4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | 5-[2,5-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-hexylthiophen-3-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCCCCCc1c(-c2scc3c2OCCO3)sc(-c2scc3c2OCCO3)c1-c1scc2c1OCCO2 |
| InChI | InChI=1S/C28H28O6S4/c1-2-3-4-5-6-16-20(25-21-17(13-35-25)29-7-10-32-21)26(28-23-19(15-37-28)31-9-12-34-23)38-24(16)27-22-18(14-36-27)30-8-11-33-22/h13-15H,2-12H2,1H3 |
| InChIKey | BXOONESEGKSPAM-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|