C18H12N2O6S3 — CID 101480670
5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-d]pyridazine-1,4-dione (PubChem CID 101480670) has the molecular formula C18H12N2O6S3 and a molecular weight of 448.50 g/mol. Its IUPAC name is 5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-d]pyridazine-1,4-dione.
| Compound Name | 5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-d]pyridazine-1,4-dione |
|---|---|
| PubChem CID | 101480670 |
| Molecular Formula | C18H12N2O6S3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-d]pyridazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2c(-c3scc4c3OCCO4)sc(-c3scc4c3OCCO4)c12 |
| InChI | InChI=1S/C18H12N2O6S3/c21-17-9-10(18(22)20-19-17)14(16-12-8(6-28-16)24-2-4-26-12)29-13(9)15-11-7(5-27-15)23-1-3-25-11/h5-6H,1-4H2,(H,19,21)(H,20,22) |
| InChIKey | CPXVMOWOIVPURZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |