C36H27NO6S3 — CID 59696867
4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-N,N-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]aniline (PubChem CID 59696867) has the molecular formula C36H27NO6S3 and a molecular weight of 665.81 g/mol. Its IUPAC name is 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-N,N-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]aniline.
| Compound Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-N,N-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]aniline |
|---|---|
| PubChem CID | 59696867 |
| Molecular Formula | C36H27NO6S3 |
| Molecular Weight | 665.81 g/mol |
| Exact Mass | 665.10 |
| IUPAC Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-N,N-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]aniline |
| SMILES | c1cc(N(c2ccc(-c3scc4c3OCCO4)cc2)c2ccc(-c3scc4c3OCCO4)cc2)ccc1-c1scc2c1OCCO2 |
| InChI | InChI=1S/C36H27NO6S3/c1-7-25(8-2-22(1)34-31-28(19-44-34)38-13-16-41-31)37(26-9-3-23(4-10-26)35-32-29(20-45-35)39-14-17-42-32)27-11-5-24(6-12-27)36-33-30(21-46-36)40-15-18-43-33/h1-12,19-21H,13-18H2 |
| InChIKey | UCYFIACMVULZOW-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.81 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |