C14H10N2O2S — CID 141358089
2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)quinoxaline (PubChem CID 141358089) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)quinoxaline.
| Compound Name | 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)quinoxaline |
|---|---|
| PubChem CID | 141358089 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)quinoxaline |
| SMILES | c1ccc2nc(-c3scc4c3OCCO4)cnc2c1 |
| InChI | InChI=1S/C14H10N2O2S/c1-2-4-10-9(3-1)15-7-11(16-10)14-13-12(8-19-14)17-5-6-18-13/h1-4,7-8H,5-6H2 |
| InChIKey | KBKVPLPJMVRUFK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |