C56H38N4O4S2 — CID 136734781
5,15-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin (PubChem CID 136734781) has the molecular formula C56H38N4O4S2 and a molecular weight of 895.08 g/mol. Its IUPAC name is 5,15-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136734781 |
| Molecular Formula | C56H38N4O4S2 |
| Molecular Weight | 895.08 g/mol |
| Exact Mass | 894.23 |
| IUPAC Name | 5,15-bis[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]-10,20-diphenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccc(-c3scc4c3OCCO4)cc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccc(-c3scc4c3OCCO4)cc2)C=C1 |
| InChI | InChI=1S/C56H38N4O4S2/c1-3-7-33(8-4-1)49-39-19-23-43(57-39)51(35-11-15-37(16-12-35)55-53-47(31-65-55)61-27-29-63-53)45-25-21-41(59-45)50(34-9-5-2-6-10-34)42-22-26-46(60-42)52(44-24-20-40(49)58-44)36-13-17-38(18-14-36)56-54-48(32-66-56)62-28-30-64-54/h1-26,31-32,57,60H,27-30H2/b49-39-,49-40-,50-41-,50-42-,51-43-,51-45-,52-44-,52-46- |
| InChIKey | YJWMBQHIWPBCDU-YTJYWMACSA-N |
| XLogP | 14.32 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.08 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |