C14H16O2S — CID 143921758
ethane;5-phenyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 143921758) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is ethane;5-phenyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | ethane;5-phenyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 143921758 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | ethane;5-phenyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CC.c1ccc(-c2scc3c2OCCO3)cc1 |
| InChI | InChI=1S/C12H10O2S.C2H6/c1-2-4-9(5-3-1)12-11-10(8-15-12)13-6-7-14-11;1-2/h1-5,8H,6-7H2;1-2H3 |
| InChIKey | KJNJQEGXPMIWNU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |