C19H19BrNO4S2+ — CID 142292526
bromomethane;4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-1-methylpyridin-1-ium (PubChem CID 142292526) has the molecular formula C19H19BrNO4S2+ and a molecular weight of 469.40 g/mol. Its IUPAC name is bromomethane;4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-1-methylpyridin-1-ium.
| Compound Name | bromomethane;4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 142292526 |
| Molecular Formula | C19H19BrNO4S2+ |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | bromomethane;4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-1-methylpyridin-1-ium |
| SMILES | CBr.C[n+]1ccc(-c2sc(-c3scc4c3OCCO4)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C18H16NO4S2.CH3Br/c1-19-4-2-11(3-5-19)16-14-15(23-9-8-22-14)18(25-16)17-13-12(10-24-17)20-6-7-21-13;1-2/h2-5,10H,6-9H2,1H3;1H3/q+1; |
| InChIKey | DOGSDWVJVMAWEE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|