C22H22O9S4 — CID 164725139
[6,8-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepin-3-yl]methyl methanesulfonate (PubChem CID 164725139) has the molecular formula C22H22O9S4 and a molecular weight of 558.68 g/mol. Its IUPAC name is [6,8-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepin-3-yl]methyl methanesulfonate.
| Compound Name | [6,8-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepin-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 164725139 |
| Molecular Formula | C22H22O9S4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | [6,8-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepin-3-yl]methyl methanesulfonate |
| SMILES | CC1(COS(C)(=O)=O)COc2c(-c3scc4c3OCCO4)sc(-c3scc4c3OCCO4)c2OC1 |
| InChI | InChI=1S/C22H22O9S4/c1-22(11-31-35(2,23)24)9-29-16-17(30-10-22)21(19-15-13(8-33-19)26-4-6-28-15)34-20(16)18-14-12(7-32-18)25-3-5-27-14/h7-8H,3-6,9-11H2,1-2H3 |
| InChIKey | LLVUPZSPHIRMTP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|