C29H38O9S3Si — CID 102520742
5-[5-[7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]pentyl-triethoxysilane (PubChem CID 102520742) has the molecular formula C29H38O9S3Si and a molecular weight of 654.90 g/mol. Its IUPAC name is 5-[5-[7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]pentyl-triethoxysilane.
| Compound Name | 5-[5-[7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]pentyl-triethoxysilane |
|---|---|
| PubChem CID | 102520742 |
| Molecular Formula | C29H38O9S3Si |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.14 |
| IUPAC Name | 5-[5-[7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]pentyl-triethoxysilane |
| SMILES | CCO[Si](CCCCCc1sc(-c2sc(-c3scc4c3OCCO4)c3c2OCCO3)c2c1OCCO2)(OCC)OCC |
| InChI | InChI=1S/C29H38O9S3Si/c1-4-36-42(37-5-2,38-6-3)17-9-7-8-10-20-22-23(33-14-13-32-22)28(40-20)29-25-24(34-15-16-35-25)27(41-29)26-21-19(18-39-26)30-11-12-31-21/h18H,4-17H2,1-3H3 |
| InChIKey | GWKZBMRAPLLNSR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|