C36H44N2O4S2 — CID 101010178
5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-heptyl-2-pyridinyl]-4-heptylpyridine (PubChem CID 101010178) has the molecular formula C36H44N2O4S2 and a molecular weight of 632.89 g/mol. Its IUPAC name is 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-heptyl-2-pyridinyl]-4-heptylpyridine.
| Compound Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-heptyl-2-pyridinyl]-4-heptylpyridine |
|---|---|
| PubChem CID | 101010178 |
| Molecular Formula | C36H44N2O4S2 |
| Molecular Weight | 632.89 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4-heptyl-2-pyridinyl]-4-heptylpyridine |
| SMILES | CCCCCCCc1cc(-c2cc(CCCCCCC)c(-c3scc4c3OCCO4)cn2)ncc1-c1scc2c1OCCO2 |
| InChI | InChI=1S/C36H44N2O4S2/c1-3-5-7-9-11-13-25-19-29(37-21-27(25)35-33-31(23-43-35)39-15-17-41-33)30-20-26(14-12-10-8-6-4-2)28(22-38-30)36-34-32(24-44-36)40-16-18-42-34/h19-24H,3-18H2,1-2H3 |
| InChIKey | SYUKCJYBQPWCHZ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.89 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|