C17H11N3O4S2Se — CID 122384326
4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-[1,2,5]selenadiazolo[3,4-c]pyridine (PubChem CID 122384326) has the molecular formula C17H11N3O4S2Se and a molecular weight of 464.39 g/mol. Its IUPAC name is 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-[1,2,5]selenadiazolo[3,4-c]pyridine.
| Compound Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-[1,2,5]selenadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 122384326 |
| Molecular Formula | C17H11N3O4S2Se |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.94 |
| IUPAC Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-[1,2,5]selenadiazolo[3,4-c]pyridine |
| SMILES | c1sc(-c2cnc(-c3scc4c3OCCO4)c3n[se]nc23)c2c1OCCO2 |
| InChI | InChI=1S/C17H11N3O4S2Se/c1-3-23-14-9(21-1)6-25-16(14)8-5-18-13(12-11(8)19-27-20-12)17-15-10(7-26-17)22-2-4-24-15/h5-7H,1-4H2 |
| InChIKey | HMOMFSNCBWXZKI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|