C25H18N2O6S3 — CID 102263991
2,4,7-tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1H-benzimidazole (PubChem CID 102263991) has the molecular formula C25H18N2O6S3 and a molecular weight of 538.63 g/mol. Its IUPAC name is 2,4,7-tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1H-benzimidazole.
| Compound Name | 2,4,7-tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 102263991 |
| Molecular Formula | C25H18N2O6S3 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | 2,4,7-tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1H-benzimidazole |
| SMILES | c1sc(-c2nc3c(-c4scc5c4OCCO5)ccc(-c4scc5c4OCCO5)c3[nH]2)c2c1OCCO2 |
| InChI | InChI=1S/C25H18N2O6S3/c1-2-13(23-20-15(10-35-23)29-4-7-32-20)18-17(12(1)22-19-14(9-34-22)28-3-6-31-19)26-25(27-18)24-21-16(11-36-24)30-5-8-33-21/h1-2,9-11H,3-8H2,(H,26,27) |
| InChIKey | FRODCBMSZIVOMQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |