C25H22O3S2 — CID 18710400
5-[5-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-4,8-dimethylnaphthalen-1-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 18710400) has the molecular formula C25H22O3S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 5-[5-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-4,8-dimethylnaphthalen-1-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[5-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-4,8-dimethylnaphthalen-1-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 18710400 |
| Molecular Formula | C25H22O3S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 5-[5-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-4,8-dimethylnaphthalen-1-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | Cc1ccc(-c2scc3c2OCCO3)c2c(C)ccc(-c3scc4c3OCCC4)c12 |
| InChI | InChI=1S/C25H22O3S2/c1-14-6-8-18(25-23-19(13-30-25)26-10-11-28-23)21-15(2)5-7-17(20(14)21)24-22-16(12-29-24)4-3-9-27-22/h5-8,12-13H,3-4,9-11H2,1-2H3 |
| InChIKey | BQHXJLLERUIMEM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |