C15H16O4S3 — CID 147519853
7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-5-propan-2-ylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 147519853) has the molecular formula C15H16O4S3 and a molecular weight of 356.49 g/mol. Its IUPAC name is 7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-5-propan-2-ylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-5-propan-2-ylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 147519853 |
| Molecular Formula | C15H16O4S3 |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 7-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-5-propan-2-ylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CC(C)Sc1sc(-c2scc3c2OCCO3)c2c1OCCO2 |
| InChI | InChI=1S/C15H16O4S3/c1-8(2)21-15-12-11(18-5-6-19-12)14(22-15)13-10-9(7-20-13)16-3-4-17-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | FKYIWVVGQKRDBK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |