C18H15O6PS3 — CID 86053872
tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phosphane (PubChem CID 86053872) has the molecular formula C18H15O6PS3 and a molecular weight of 454.49 g/mol. Its IUPAC name is tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phosphane.
| Compound Name | tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phosphane |
|---|---|
| PubChem CID | 86053872 |
| Molecular Formula | C18H15O6PS3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | tris(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phosphane |
| SMILES | c1sc(P(c2scc3c2OCCO3)c2scc3c2OCCO3)c2c1OCCO2 |
| InChI | InChI=1S/C18H15O6PS3/c1-4-22-13-10(19-1)7-26-16(13)25(17-14-11(8-27-17)20-2-5-23-14)18-15-12(9-28-18)21-3-6-24-15/h7-9H,1-6H2 |
| InChIKey | RRSYKDNYIPOOEI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|