About 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine
6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine (PubChem CID 96596041) has the molecular formula C7H7BrO2S
and a molecular weight of 235.10 g/mol. Its IUPAC name is 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine.
Analyze 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine?
The IUPAC name of 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine (CID 96596041) is 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine.
What is the SMILES notation for 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine?
The canonical SMILES for 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine is Brc1scc2c1OCCCO2.
What is the InChIKey of 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine?
The InChIKey is WWIPDUOSMYCPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO2S/c8-7-6-5(4-11-7)9-2-1-3-10-6/h4H,1-3H2.
What are the key properties of 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine?
6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine has a molecular weight of 235.10 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine is sourced from PubChem (CID 96596041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).