C17H28O3S — CID 11001471
2,2,4,4-tetramethyl-3-(2,3,4,5-tetrahydrothieno[3,4-b][1,4]dioxocin-7-yl)pentan-3-ol (PubChem CID 11001471) has the molecular formula C17H28O3S and a molecular weight of 312.48 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-3-(2,3,4,5-tetrahydrothieno[3,4-b][1,4]dioxocin-7-yl)pentan-3-ol.
| Compound Name | 2,2,4,4-tetramethyl-3-(2,3,4,5-tetrahydrothieno[3,4-b][1,4]dioxocin-7-yl)pentan-3-ol |
|---|---|
| PubChem CID | 11001471 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2,2,4,4-tetramethyl-3-(2,3,4,5-tetrahydrothieno[3,4-b][1,4]dioxocin-7-yl)pentan-3-ol |
| SMILES | CC(C)(C)C(O)(c1scc2c1OCCCCO2)C(C)(C)C |
| InChI | InChI=1S/C17H28O3S/c1-15(2,3)17(18,16(4,5)6)14-13-12(11-21-14)19-9-7-8-10-20-13/h11,18H,7-10H2,1-6H3 |
| InChIKey | QPOQATQWIQUENG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |