C38H36O4S6Si2 — CID 101401030
[2,4-bis[5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]thiophen-2-yl]-3-trimethylsilylcyclobuta-1,3-dien-1-yl]-trimethylsilane (PubChem CID 101401030) has the molecular formula C38H36O4S6Si2 and a molecular weight of 805.28 g/mol. Its IUPAC name is [2,4-bis[5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]thiophen-2-yl]-3-trimethylsilylcyclobuta-1,3-dien-1-yl]-trimethylsilane.
| Compound Name | [2,4-bis[5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]thiophen-2-yl]-3-trimethylsilylcyclobuta-1,3-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101401030 |
| Molecular Formula | C38H36O4S6Si2 |
| Molecular Weight | 805.28 g/mol |
| Exact Mass | 804.05 |
| IUPAC Name | [2,4-bis[5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]thiophen-2-yl]-3-trimethylsilylcyclobuta-1,3-dien-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C(c2ccc(-c3ccc(-c4scc5c4OCCO5)s3)s2)C([Si](C)(C)C)=C1c1ccc(-c2ccc(-c3scc4c3OCCO4)s2)s1 |
| InChI | InChI=1S/C38H36O4S6Si2/c1-49(2,3)37-31(27-11-7-23(45-27)25-9-13-29(47-25)35-33-21(19-43-35)39-15-17-41-33)38(50(4,5)6)32(37)28-12-8-24(46-28)26-10-14-30(48-26)36-34-22(20-44-36)40-16-18-42-34/h7-14,19-20H,15-18H2,1-6H3 |
| InChIKey | KZJPPLPDWFBEJQ-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.28 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|