C16H12ClNO6S — CID 9031319
(E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-(4-nitrophenyl)sulfanylprop-2-enoic acid (PubChem CID 9031319) has the molecular formula C16H12ClNO6S and a molecular weight of 381.79 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-(4-nitrophenyl)sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-(4-nitrophenyl)sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 9031319 |
| Molecular Formula | C16H12ClNO6S |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | (E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)-2-(4-nitrophenyl)sulfanylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(/Sc2ccc([N+](=O)[O-])cc2)C(=O)O)cc(Cl)c1O |
| InChI | InChI=1S/C16H12ClNO6S/c1-24-13-7-9(6-12(17)15(13)19)8-14(16(20)21)25-11-4-2-10(3-5-11)18(22)23/h2-8,19H,1H3,(H,20,21)/b14-8+ |
| InChIKey | KZESYNDBVYZHAY-RIYZIHGNSA-N |
| XLogP | 4.18 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|