C26H26FN3O2P+ — CID 90314762
4-[[3-(1-benzyl-4-hydroxy-1,4-azaphosphinan-4-ium-4-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 90314762) has the molecular formula C26H26FN3O2P+ and a molecular weight of 462.49 g/mol. Its IUPAC name is 4-[[3-(1-benzyl-4-hydroxy-1,4-azaphosphinan-4-ium-4-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-(1-benzyl-4-hydroxy-1,4-azaphosphinan-4-ium-4-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 90314762 |
| Molecular Formula | C26H26FN3O2P+ |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-[[3-(1-benzyl-4-hydroxy-1,4-azaphosphinan-4-ium-4-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cc2ccc(F)c([P+]3(O)CCN(Cc4ccccc4)CC3)c2)c2ccccc12 |
| InChI | InChI=1S/C26H25FN3O2P/c27-23-11-10-20(16-24-21-8-4-5-9-22(21)26(31)29-28-24)17-25(23)33(32)14-12-30(13-15-33)18-19-6-2-1-3-7-19/h1-11,17,32H,12-16,18H2/p+1 |
| InChIKey | IGBKQLGGHFRSAG-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|