C23H27FN3O2P — CID 71078327
4-[[4-fluoro-3-[1-(2-methylpropyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 71078327) has the molecular formula C23H27FN3O2P and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[1-(2-methylpropyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[1-(2-methylpropyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 71078327 |
| Molecular Formula | C23H27FN3O2P |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[[4-fluoro-3-[1-(2-methylpropyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | CC(C)CN1CCP(=O)(c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C23H27FN3O2P/c1-16(2)15-27-9-11-30(29,12-10-27)22-14-17(7-8-20(22)24)13-21-18-5-3-4-6-19(18)23(28)26-25-21/h3-8,14,16H,9-13,15H2,1-2H3,(H,26,28) |
| InChIKey | HVNVSIFJDWYBMH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|