C25H27FN3O3P — CID 71078065
4-[[3-[1-(cyclopentanecarbonyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 71078065) has the molecular formula C25H27FN3O3P and a molecular weight of 467.48 g/mol. Its IUPAC name is 4-[[3-[1-(cyclopentanecarbonyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[1-(cyclopentanecarbonyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 71078065 |
| Molecular Formula | C25H27FN3O3P |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4-[[3-[1-(cyclopentanecarbonyl)-4-oxo-1,4λ5-azaphosphinan-4-yl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=C(C1CCCC1)N1CCP(=O)(c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C25H27FN3O3P/c26-21-10-9-17(15-22-19-7-3-4-8-20(19)24(30)28-27-22)16-23(21)33(32)13-11-29(12-14-33)25(31)18-5-1-2-6-18/h3-4,7-10,16,18H,1-2,5-6,11-15H2,(H,28,30) |
| InChIKey | VRMUFOYCHGHIQR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|