C25H33N3O5 — CID 90319814
acetyl acetate;1-[1-(2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]pentyl acetate (PubChem CID 90319814) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is acetyl acetate;1-[1-(2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]pentyl acetate.
| Compound Name | acetyl acetate;1-[1-(2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]pentyl acetate |
|---|---|
| PubChem CID | 90319814 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | acetyl acetate;1-[1-(2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]pentyl acetate |
| SMILES | CC(=O)OC(C)=O.CCCCC(OC(C)=O)c1nc2cnc3ccccc3c2n1CC(C)C |
| InChI | InChI=1S/C21H27N3O2.C4H6O3/c1-5-6-11-19(26-15(4)25)21-23-18-12-22-17-10-8-7-9-16(17)20(18)24(21)13-14(2)3;1-3(5)7-4(2)6/h7-10,12,14,19H,5-6,11,13H2,1-4H3;1-2H3 |
| InChIKey | PRMURUNXYMSPCU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|