C12H14N4O — CID 90320301
4-(8-methylpyrido[2,3-b]pyrazin-3-yl)morpholine (PubChem CID 90320301) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-(8-methylpyrido[2,3-b]pyrazin-3-yl)morpholine.
| Compound Name | 4-(8-methylpyrido[2,3-b]pyrazin-3-yl)morpholine |
|---|---|
| PubChem CID | 90320301 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-(8-methylpyrido[2,3-b]pyrazin-3-yl)morpholine |
| SMILES | Cc1ccnc2nc(N3CCOCC3)cnc12 |
| InChI | InChI=1S/C12H14N4O/c1-9-2-3-13-12-11(9)14-8-10(15-12)16-4-6-17-7-5-16/h2-3,8H,4-7H2,1H3 |
| InChIKey | HNNVBPFOXIOBGP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |