C20H30N4O6S2 — CID 90321326
(1S,7S,10S,16E,21R)-7-methyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone (PubChem CID 90321326) has the molecular formula C20H30N4O6S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is (1S,7S,10S,16E,21R)-7-methyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone.
| Compound Name | (1S,7S,10S,16E,21R)-7-methyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 90321326 |
| Molecular Formula | C20H30N4O6S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (1S,7S,10S,16E,21R)-7-methyl-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| SMILES | CC(C)[C@H]1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC1=O)C(=O)N[C@@H](C)C(=O)NCC(=O)O2 |
| InChI | InChI=1S/C20H30N4O6S2/c1-11(2)17-20(29)23-14-10-32-31-7-5-4-6-13(8-15(25)24-17)30-16(26)9-21-18(27)12(3)22-19(14)28/h4,6,11-14,17H,5,7-10H2,1-3H3,(H,21,27)(H,22,28)(H,23,29)(H,24,25)/b6-4+/t12-,13+,14+,17+/m0/s1 |
| InChIKey | KBZNWUYWTVLQMZ-KCYGMNOSSA-N |
| XLogP | -0.11 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|