C10H16O2 — CID 90324109
3-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]propanal (PubChem CID 90324109) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]propanal.
| Compound Name | 3-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]propanal |
|---|---|
| PubChem CID | 90324109 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]propanal |
| SMILES | C=C1C[C@H](CCC=O)O[C@H]1CC |
| InChI | InChI=1S/C10H16O2/c1-3-10-8(2)7-9(12-10)5-4-6-11/h6,9-10H,2-5,7H2,1H3/t9-,10-/m0/s1 |
| InChIKey | OUOAOHHHWICPGX-UWVGGRQHSA-N |
| XLogP | 2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|