C24H22ClN5O2S — CID 90326728
1-[3-(2-tert-butyl-4-pyrimidin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(4-chlorophenyl)-1-hydroxyurea (PubChem CID 90326728) has the molecular formula C24H22ClN5O2S and a molecular weight of 479.99 g/mol. Its IUPAC name is 1-[3-(2-tert-butyl-4-pyrimidin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(4-chlorophenyl)-1-hydroxyurea.
| Compound Name | 1-[3-(2-tert-butyl-4-pyrimidin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(4-chlorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 90326728 |
| Molecular Formula | C24H22ClN5O2S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1-[3-(2-tert-butyl-4-pyrimidin-4-yl-1,3-thiazol-5-yl)phenyl]-3-(4-chlorophenyl)-1-hydroxyurea |
| SMILES | CC(C)(C)c1nc(-c2ccncn2)c(-c2cccc(N(O)C(=O)Nc3ccc(Cl)cc3)c2)s1 |
| InChI | InChI=1S/C24H22ClN5O2S/c1-24(2,3)22-29-20(19-11-12-26-14-27-19)21(33-22)15-5-4-6-18(13-15)30(32)23(31)28-17-9-7-16(25)8-10-17/h4-14,32H,1-3H3,(H,28,31) |
| InChIKey | KSFUCUJVLFDSKY-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|