C9H12F2O3 — CID 90328385
(4,4-difluoro-2-oxopentyl) 2-methylprop-2-enoate (PubChem CID 90328385) has the molecular formula C9H12F2O3 and a molecular weight of 206.19 g/mol. Its IUPAC name is (4,4-difluoro-2-oxopentyl) 2-methylprop-2-enoate.
| Compound Name | (4,4-difluoro-2-oxopentyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90328385 |
| Molecular Formula | C9H12F2O3 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (4,4-difluoro-2-oxopentyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)CC(C)(F)F |
| InChI | InChI=1S/C9H12F2O3/c1-6(2)8(13)14-5-7(12)4-9(3,10)11/h1,4-5H2,2-3H3 |
| InChIKey | QLEWVNXCVOLGPW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|