C15H10F14O6 — CID 53251621
2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate (PubChem CID 53251621) has the molecular formula C15H10F14O6 and a molecular weight of 552.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 53251621 |
| Molecular Formula | C15H10F14O6 |
| Molecular Weight | 552.21 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H10F14O6/c1-5(2)7(31)33-3-6(30)35-11(14(24,25)26,15(27,28)29)9(32)34-4-10(18,19)13(22,23)12(20,21)8(16)17/h8H,1,3-4H2,2H3 |
| InChIKey | XALBDUKKLFGQPY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|