C26H25ClO2 — CID 90330817
4-[(E)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]benzaldehyde (PubChem CID 90330817) has the molecular formula C26H25ClO2 and a molecular weight of 404.94 g/mol. Its IUPAC name is 4-[(E)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]benzaldehyde.
| Compound Name | 4-[(E)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]benzaldehyde |
|---|---|
| PubChem CID | 90330817 |
| Molecular Formula | C26H25ClO2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[(E)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]benzaldehyde |
| SMILES | Cc1ccc(/C=C(\CCCOc2ccc(C=O)cc2)c2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C26H25ClO2/c1-19-8-9-22(15-20(19)2)16-23(24-5-3-7-25(27)17-24)6-4-14-29-26-12-10-21(18-28)11-13-26/h3,5,7-13,15-18H,4,6,14H2,1-2H3/b23-16+ |
| InChIKey | PPZCTSOIENKRFE-XQNSMLJCSA-N |
| XLogP | 7.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|