C28H29N3O4 — CID 90331707
[2-[4-[(3-benzamidobenzoyl)amino]phenyl]cyclopropyl]-tert-butylcarbamic acid (PubChem CID 90331707) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is [2-[4-[(3-benzamidobenzoyl)amino]phenyl]cyclopropyl]-tert-butylcarbamic acid.
| Compound Name | [2-[4-[(3-benzamidobenzoyl)amino]phenyl]cyclopropyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 90331707 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [2-[4-[(3-benzamidobenzoyl)amino]phenyl]cyclopropyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CC1c1ccc(NC(=O)c2cccc(NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H29N3O4/c1-28(2,3)31(27(34)35)24-17-23(24)18-12-14-21(15-13-18)29-26(33)20-10-7-11-22(16-20)30-25(32)19-8-5-4-6-9-19/h4-16,23-24H,17H2,1-3H3,(H,29,33)(H,30,32)(H,34,35) |
| InChIKey | ZNHROQZFUMFCCI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |