C21H24N2O3 — CID 90214249
[(1R,2S)-2-[4-[(3-tert-butylbenzoyl)amino]phenyl]cyclopropyl]carbamic acid (PubChem CID 90214249) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(1R,2S)-2-[4-[(3-tert-butylbenzoyl)amino]phenyl]cyclopropyl]carbamic acid.
| Compound Name | [(1R,2S)-2-[4-[(3-tert-butylbenzoyl)amino]phenyl]cyclopropyl]carbamic acid |
|---|---|
| PubChem CID | 90214249 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(1R,2S)-2-[4-[(3-tert-butylbenzoyl)amino]phenyl]cyclopropyl]carbamic acid |
| SMILES | CC(C)(C)c1cccc(C(=O)Nc2ccc([C@@H]3C[C@H]3NC(=O)O)cc2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-21(2,3)15-6-4-5-14(11-15)19(24)22-16-9-7-13(8-10-16)17-12-18(17)23-20(25)26/h4-11,17-18,23H,12H2,1-3H3,(H,22,24)(H,25,26)/t17-,18+/m0/s1 |
| InChIKey | FFYFIRSIBDLGMQ-ZWKOTPCHSA-N |
| XLogP | 4.36 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |