C22H34N8O2 — CID 90333081
1-[[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonyl]amino]-1-methylurea (PubChem CID 90333081) has the molecular formula C22H34N8O2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 1-[[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonyl]amino]-1-methylurea.
| Compound Name | 1-[[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonyl]amino]-1-methylurea |
|---|---|
| PubChem CID | 90333081 |
| Molecular Formula | C22H34N8O2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-[[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonyl]amino]-1-methylurea |
| SMILES | CC1CCC(Cn2cnc3nc(C(=O)NN(C)C(N)=O)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C22H34N8O2/c1-13-7-9-15(10-8-13)11-30-12-24-18-17(30)19(25-14(2)16-5-4-6-16)27-20(26-18)21(31)28-29(3)22(23)32/h12-16H,4-11H2,1-3H3,(H2,23,32)(H,28,31)(H,25,26,27)/t13?,14-,15?/m1/s1 |
| InChIKey | VCIPEAMPTZNTID-SHARSMKWSA-N |
| XLogP | 2.91 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|