C20H31N7O — CID 90333301
6-(2-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carbohydrazide (PubChem CID 90333301) has the molecular formula C20H31N7O and a molecular weight of 385.52 g/mol. Its IUPAC name is 6-(2-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carbohydrazide.
| Compound Name | 6-(2-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carbohydrazide |
|---|---|
| PubChem CID | 90333301 |
| Molecular Formula | C20H31N7O |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 6-(2-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]purine-2-carbohydrazide |
| SMILES | CC1CCC(Cn2cnc3nc(C(=O)NN)nc(NCCC4CCC4)c32)CC1 |
| InChI | InChI=1S/C20H31N7O/c1-13-5-7-15(8-6-13)11-27-12-23-18-16(27)17(22-10-9-14-3-2-4-14)24-19(25-18)20(28)26-21/h12-15H,2-11,21H2,1H3,(H,26,28)(H,22,24,25) |
| InChIKey | DGKQQONGFFYZIB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|