C21H28N6 — CID 90333230
6-(1-cyclobutylethylamino)-7-(spiro[2.5]octan-6-ylmethyl)purine-2-carbonitrile (PubChem CID 90333230) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is 6-(1-cyclobutylethylamino)-7-(spiro[2.5]octan-6-ylmethyl)purine-2-carbonitrile.
| Compound Name | 6-(1-cyclobutylethylamino)-7-(spiro[2.5]octan-6-ylmethyl)purine-2-carbonitrile |
|---|---|
| PubChem CID | 90333230 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 6-(1-cyclobutylethylamino)-7-(spiro[2.5]octan-6-ylmethyl)purine-2-carbonitrile |
| SMILES | CC(Nc1nc(C#N)nc2ncn(CC3CCC4(CC3)CC4)c12)C1CCC1 |
| InChI | InChI=1S/C21H28N6/c1-14(16-3-2-4-16)24-20-18-19(25-17(11-22)26-20)23-13-27(18)12-15-5-7-21(8-6-15)9-10-21/h13-16H,2-10,12H2,1H3,(H,24,25,26) |
| InChIKey | GYAAMWXMHKBAGQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |