C27H30F3N7O6 — CID 90333527
methyl 2-[[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]amino]-2-oxoacetate (PubChem CID 90333527) has the molecular formula C27H30F3N7O6 and a molecular weight of 605.57 g/mol. Its IUPAC name is methyl 2-[[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 90333527 |
| Molecular Formula | C27H30F3N7O6 |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | methyl 2-[[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCC(C)(C)CNC(=O)c1ccc(Nc2nc(NCc3ccc(O)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C27H30F3N7O6/c1-26(2,14-33-21(40)22(41)42-3)13-32-20(39)17-6-8-18(9-7-17)34-24-35-23(31-12-16-4-10-19(38)11-5-16)36-25(37-24)43-15-27(28,29)30/h4-11,38H,12-15H2,1-3H3,(H,32,39)(H,33,40)(H2,31,34,35,36,37) |
| InChIKey | DUVYTONHBZYHSH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 176.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|