C22H32BN3O7S — CID 90333577
N-methyl-6-[methyl(methylsulfonyl)amino]-2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide (PubChem CID 90333577) has the molecular formula C22H32BN3O7S and a molecular weight of 493.39 g/mol. Its IUPAC name is N-methyl-6-[methyl(methylsulfonyl)amino]-2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide.
| Compound Name | N-methyl-6-[methyl(methylsulfonyl)amino]-2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 90333577 |
| Molecular Formula | C22H32BN3O7S |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-methyl-6-[methyl(methylsulfonyl)amino]-2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(N2CCOCC2)oc2cc(N(C)S(C)(=O)=O)c(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C22H32BN3O7S/c1-21(2)22(3,4)33-23(32-21)15-12-14-17(13-16(15)25(6)34(7,28)29)31-20(18(14)19(27)24-5)26-8-10-30-11-9-26/h12-13H,8-11H2,1-7H3,(H,24,27) |
| InChIKey | FBZNPENEMVNMIE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|