C15H18N4O — CID 90333819
N-[2-amino-5-[2-(1-methylpyrazol-4-yl)ethyl]phenyl]prop-2-enamide (PubChem CID 90333819) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-[2-amino-5-[2-(1-methylpyrazol-4-yl)ethyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-amino-5-[2-(1-methylpyrazol-4-yl)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90333819 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[2-amino-5-[2-(1-methylpyrazol-4-yl)ethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(CCc2cnn(C)c2)ccc1N |
| InChI | InChI=1S/C15H18N4O/c1-3-15(20)18-14-8-11(6-7-13(14)16)4-5-12-9-17-19(2)10-12/h3,6-10H,1,4-5,16H2,2H3,(H,18,20) |
| InChIKey | YZRVZCODUYNIFI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|