C16H25NO — CID 90335969
(3S,4R)-3-amino-1-(2-ethylphenyl)-4,5-dimethylhexan-2-one (PubChem CID 90335969) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (3S,4R)-3-amino-1-(2-ethylphenyl)-4,5-dimethylhexan-2-one.
| Compound Name | (3S,4R)-3-amino-1-(2-ethylphenyl)-4,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 90335969 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3S,4R)-3-amino-1-(2-ethylphenyl)-4,5-dimethylhexan-2-one |
| SMILES | CCc1ccccc1CC(=O)[C@@H](N)[C@H](C)C(C)C |
| InChI | InChI=1S/C16H25NO/c1-5-13-8-6-7-9-14(13)10-15(18)16(17)12(4)11(2)3/h6-9,11-12,16H,5,10,17H2,1-4H3/t12-,16+/m1/s1 |
| InChIKey | CECNPHOHFCEUHU-WBMJQRKESA-N |
| XLogP | 2.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |