C17H27NO — CID 90337050
1-[3-(cyclohexylmethylamino)phenyl]-2,2-dideuteriobutan-1-ol (PubChem CID 90337050) has the molecular formula C17H27NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 1-[3-(cyclohexylmethylamino)phenyl]-2,2-dideuteriobutan-1-ol.
| Compound Name | 1-[3-(cyclohexylmethylamino)phenyl]-2,2-dideuteriobutan-1-ol |
|---|---|
| PubChem CID | 90337050 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-[3-(cyclohexylmethylamino)phenyl]-2,2-dideuteriobutan-1-ol |
| SMILES | [2H]C([2H])(CC)C(O)c1cccc(NCC2CCCCC2)c1 |
| InChI | InChI=1S/C17H27NO/c1-2-7-17(19)15-10-6-11-16(12-15)18-13-14-8-4-3-5-9-14/h6,10-12,14,17-19H,2-5,7-9,13H2,1H3/i7D2 |
| InChIKey | AQORMUDFUMWGNO-RJSZUWSASA-N |
| XLogP | 4.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |