C31H27FN4O4S — CID 90339301
4-[4-[[(E)-3-(4-fluorophenyl)-2-(1-methylsulfinylethylideneamino)-3-phenylprop-2-enoyl]amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 90339301) has the molecular formula C31H27FN4O4S and a molecular weight of 570.65 g/mol. Its IUPAC name is 4-[4-[[(E)-3-(4-fluorophenyl)-2-(1-methylsulfinylethylideneamino)-3-phenylprop-2-enoyl]amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[(E)-3-(4-fluorophenyl)-2-(1-methylsulfinylethylideneamino)-3-phenylprop-2-enoyl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 90339301 |
| Molecular Formula | C31H27FN4O4S |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 4-[4-[[(E)-3-(4-fluorophenyl)-2-(1-methylsulfinylethylideneamino)-3-phenylprop-2-enoyl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)C(/N=C(\C)S(C)=O)=C(/c3ccccc3)c3ccc(F)cc3)cc2)ccn1 |
| InChI | InChI=1S/C31H27FN4O4S/c1-20(41(3)39)35-29(28(21-7-5-4-6-8-21)22-9-11-23(32)12-10-22)31(38)36-24-13-15-25(16-14-24)40-26-17-18-34-27(19-26)30(37)33-2/h4-19H,1-3H3,(H,33,37)(H,36,38)/b29-28+,35-20+ |
| InChIKey | WRIYKCXWQCAIAJ-KANQJGISSA-N |
| XLogP | 5.57 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|