C31H26ClNO5 — CID 90339827
[4-[2-(2-phenylphenyl)ethylcarbamoyl]phenyl] 6-chloro-3,4-dihydro-2H-chromene-4-carboperoxoate (PubChem CID 90339827) has the molecular formula C31H26ClNO5 and a molecular weight of 528.00 g/mol. Its IUPAC name is [4-[2-(2-phenylphenyl)ethylcarbamoyl]phenyl] 6-chloro-3,4-dihydro-2H-chromene-4-carboperoxoate.
| Compound Name | [4-[2-(2-phenylphenyl)ethylcarbamoyl]phenyl] 6-chloro-3,4-dihydro-2H-chromene-4-carboperoxoate |
|---|---|
| PubChem CID | 90339827 |
| Molecular Formula | C31H26ClNO5 |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | [4-[2-(2-phenylphenyl)ethylcarbamoyl]phenyl] 6-chloro-3,4-dihydro-2H-chromene-4-carboperoxoate |
| SMILES | O=C(NCCc1ccccc1-c1ccccc1)c1ccc(OOC(=O)C2CCOc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C31H26ClNO5/c32-24-12-15-29-28(20-24)27(17-19-36-29)31(35)38-37-25-13-10-23(11-14-25)30(34)33-18-16-22-8-4-5-9-26(22)21-6-2-1-3-7-21/h1-15,20,27H,16-19H2,(H,33,34) |
| InChIKey | BPTSWADVWRMLHH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|