C28H33ClN2O3SSi — CID 90341927
(1R,2R)-1-[1-(benzenesulfonyl)indol-2-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethanamine (PubChem CID 90341927) has the molecular formula C28H33ClN2O3SSi and a molecular weight of 541.19 g/mol. Its IUPAC name is (1R,2R)-1-[1-(benzenesulfonyl)indol-2-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethanamine.
| Compound Name | (1R,2R)-1-[1-(benzenesulfonyl)indol-2-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 90341927 |
| Molecular Formula | C28H33ClN2O3SSi |
| Molecular Weight | 541.19 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | (1R,2R)-1-[1-(benzenesulfonyl)indol-2-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethanamine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](c1cccc(Cl)c1)[C@H](N)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H33ClN2O3SSi/c1-28(2,3)36(4,5)34-27(21-13-11-14-22(29)18-21)26(30)25-19-20-12-9-10-17-24(20)31(25)35(32,33)23-15-7-6-8-16-23/h6-19,26-27H,30H2,1-5H3/t26-,27-/m1/s1 |
| InChIKey | HLBVSJJCQYRVIG-KAYWLYCHSA-N |
| XLogP | 7.29 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.19 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|