C19H29N5O3 — CID 90342902
2-[1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl]-4-propan-2-ylpiperazine-1-carboxylic acid (PubChem CID 90342902) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl]-4-propan-2-ylpiperazine-1-carboxylic acid.
| Compound Name | 2-[1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl]-4-propan-2-ylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 90342902 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2-[1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl]-4-propan-2-ylpiperazine-1-carboxylic acid |
| SMILES | CC(C)N1CCN(C(=O)O)C(C2CCN(c3ccc(C(N)=O)cn3)CC2)C1 |
| InChI | InChI=1S/C19H29N5O3/c1-13(2)23-9-10-24(19(26)27)16(12-23)14-5-7-22(8-6-14)17-4-3-15(11-21-17)18(20)25/h3-4,11,13-14,16H,5-10,12H2,1-2H3,(H2,20,25)(H,26,27) |
| InChIKey | PRLOCXOLFFIYAN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |